C14H15F3N2O4S — CID 55809279
N-(2-oxoazepan-3-yl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55809279) has the molecular formula C14H15F3N2O4S and a molecular weight of 364.35 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(2-oxoazepan-3-yl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55809279 |
| Molecular Formula | C14H15F3N2O4S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NC1CCCCNC1=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N2O4S/c15-14(16,17)24(22,23)10-6-4-9(5-7-10)12(20)19-11-3-1-2-8-18-13(11)21/h4-7,11H,1-3,8H2,(H,18,21)(H,19,20) |
| InChIKey | LKDZEQKXGHBIMI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |