C14H17BrN2O2 — CID 102851110
4-(bromomethyl)-N-(2-oxoazepan-3-yl)benzamide (PubChem CID 102851110) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(2-oxoazepan-3-yl)benzamide.
| Compound Name | 4-(bromomethyl)-N-(2-oxoazepan-3-yl)benzamide |
|---|---|
| PubChem CID | 102851110 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-(bromomethyl)-N-(2-oxoazepan-3-yl)benzamide |
| SMILES | O=C(NC1CCCCNC1=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H17BrN2O2/c15-9-10-4-6-11(7-5-10)13(18)17-12-3-1-2-8-16-14(12)19/h4-7,12H,1-3,8-9H2,(H,16,19)(H,17,18) |
| InChIKey | TUTKUCUEUMTSEN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|