C21H21N3O2S2 — CID 75403823
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-(2-oxoazepan-3-yl)benzamide (PubChem CID 75403823) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-(2-oxoazepan-3-yl)benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-(2-oxoazepan-3-yl)benzamide |
|---|---|
| PubChem CID | 75403823 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-(2-oxoazepan-3-yl)benzamide |
| SMILES | O=C(NC1CCCCNC1=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H21N3O2S2/c25-19(23-17-6-3-4-12-22-20(17)26)15-10-8-14(9-11-15)13-27-21-24-16-5-1-2-7-18(16)28-21/h1-2,5,7-11,17H,3-4,6,12-13H2,(H,22,26)(H,23,25) |
| InChIKey | SLWKLAABNFEICS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |