C8H12F2N2O5S — CID 88586538
1,1-difluoro-2-oxo-2-[(2-oxoazepan-3-yl)amino]ethanesulfonic acid (PubChem CID 88586538) has the molecular formula C8H12F2N2O5S and a molecular weight of 286.26 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[(2-oxoazepan-3-yl)amino]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[(2-oxoazepan-3-yl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88586538 |
| Molecular Formula | C8H12F2N2O5S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[(2-oxoazepan-3-yl)amino]ethanesulfonic acid |
| SMILES | O=C1NCCCCC1NC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H12F2N2O5S/c9-8(10,18(15,16)17)7(14)12-5-3-1-2-4-11-6(5)13/h5H,1-4H2,(H,11,13)(H,12,14)(H,15,16,17) |
| InChIKey | KYYMXVIBDLXISU-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|