C15H16N4O3S — CID 99613769
N-[(3R)-2-oxoazepan-3-yl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide (PubChem CID 99613769) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is N-[(3R)-2-oxoazepan-3-yl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-[(3R)-2-oxoazepan-3-yl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99613769 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[(3R)-2-oxoazepan-3-yl]-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
| SMILES | O=C(N[C@@H]1CCCCNC1=O)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C15H16N4O3S/c20-12(17-11-3-1-2-8-16-13(11)21)9-4-6-10(7-5-9)14-18-19-15(23)22-14/h4-7,11H,1-3,8H2,(H,16,21)(H,17,20)(H,19,23)/t11-/m1/s1 |
| InChIKey | PGSCPQUYSWHUBU-LLVKDONJSA-N |
| XLogP | 1.80 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|