C17H17N3O2S — CID 100642338
4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]benzamide (PubChem CID 100642338) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]benzamide.
| Compound Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]benzamide |
|---|---|
| PubChem CID | 100642338 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]benzamide |
| SMILES | O=C(NC1[C@@H]2[C@H]3CC[C@@H](C3)[C@H]12)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C17H17N3O2S/c21-15(18-14-12-10-5-6-11(7-10)13(12)14)8-1-3-9(4-2-8)16-19-20-17(23)22-16/h1-4,10-14H,5-7H2,(H,18,21)(H,20,23)/t10-,11-,12-,13+,14?/m0/s1 |
| InChIKey | YZODDNNXQAXDOF-CSHRUCKSSA-N |
| XLogP | 3.17 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|