C25H27N3O6 — CID 123420478
4-methyl-N-(2-oxocyclopentyl)benzamide;4-nitro-N-(2-oxocyclopentyl)benzamide (PubChem CID 123420478) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-methyl-N-(2-oxocyclopentyl)benzamide;4-nitro-N-(2-oxocyclopentyl)benzamide.
| Compound Name | 4-methyl-N-(2-oxocyclopentyl)benzamide;4-nitro-N-(2-oxocyclopentyl)benzamide |
|---|---|
| PubChem CID | 123420478 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-methyl-N-(2-oxocyclopentyl)benzamide;4-nitro-N-(2-oxocyclopentyl)benzamide |
| SMILES | Cc1ccc(C(=O)NC2CCCC2=O)cc1.O=C(NC1CCCC1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15NO2.C12H12N2O4/c1-9-5-7-10(8-6-9)13(16)14-11-3-2-4-12(11)15;15-11-3-1-2-10(11)13-12(16)8-4-6-9(7-5-8)14(17)18/h5-8,11H,2-4H2,1H3,(H,14,16);4-7,10H,1-3H2,(H,13,16) |
| InChIKey | BPAVDJKBSKKYID-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|