C12H12N2O3 — CID 14688662
N-cyclopent-2-en-1-yl-4-nitrobenzamide (PubChem CID 14688662) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is N-cyclopent-2-en-1-yl-4-nitrobenzamide.
| Compound Name | N-cyclopent-2-en-1-yl-4-nitrobenzamide |
|---|---|
| PubChem CID | 14688662 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-cyclopent-2-en-1-yl-4-nitrobenzamide |
| SMILES | O=C(NC1C=CCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O3/c15-12(13-10-3-1-2-4-10)9-5-7-11(8-6-9)14(16)17/h1,3,5-8,10H,2,4H2,(H,13,15) |
| InChIKey | XBEPQZFRSZZBCK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|