C12H11N3O5 — CID 10378768
N-(2,6-dioxopiperidin-3-yl)-4-nitrobenzamide (PubChem CID 10378768) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-nitrobenzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 10378768 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-nitrobenzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc([N+](=O)[O-])cc2)C(=O)N1 |
| InChI | InChI=1S/C12H11N3O5/c16-10-6-5-9(12(18)14-10)13-11(17)7-1-3-8(4-2-7)15(19)20/h1-4,9H,5-6H2,(H,13,17)(H,14,16,18) |
| InChIKey | JOPHGTNZVHMBAS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|