C13H11N3O7 — CID 24993560
(2,6-dioxopiperidin-3-yl)carbamoyl 3-nitrobenzoate (PubChem CID 24993560) has the molecular formula C13H11N3O7 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2,6-dioxopiperidin-3-yl)carbamoyl 3-nitrobenzoate.
| Compound Name | (2,6-dioxopiperidin-3-yl)carbamoyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 24993560 |
| Molecular Formula | C13H11N3O7 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2,6-dioxopiperidin-3-yl)carbamoyl 3-nitrobenzoate |
| SMILES | O=C1CCC(NC(=O)OC(=O)c2cccc([N+](=O)[O-])c2)C(=O)N1 |
| InChI | InChI=1S/C13H11N3O7/c17-10-5-4-9(11(18)15-10)14-13(20)23-12(19)7-2-1-3-8(6-7)16(21)22/h1-3,6,9H,4-5H2,(H,14,20)(H,15,17,18) |
| InChIKey | PGQSWXOACOKFIJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|