C11H10N2O4 — CID 110462643
N-(2,5-dioxopyrrolidin-3-yl)-4-hydroxybenzamide (PubChem CID 110462643) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-(2,5-dioxopyrrolidin-3-yl)-4-hydroxybenzamide.
| Compound Name | N-(2,5-dioxopyrrolidin-3-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 110462643 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-(2,5-dioxopyrrolidin-3-yl)-4-hydroxybenzamide |
| SMILES | O=C1CC(NC(=O)c2ccc(O)cc2)C(=O)N1 |
| InChI | InChI=1S/C11H10N2O4/c14-7-3-1-6(2-4-7)10(16)12-8-5-9(15)13-11(8)17/h1-4,8,14H,5H2,(H,12,16)(H,13,15,17) |
| InChIKey | GWUCRHBCSIVZBL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|