C10H9N3O3 — CID 110461600
N-(2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide (PubChem CID 110461600) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is N-(2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide.
| Compound Name | N-(2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110461600 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-(2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide |
| SMILES | O=C1CC(NC(=O)c2ccccn2)C(=O)N1 |
| InChI | InChI=1S/C10H9N3O3/c14-8-5-7(10(16)13-8)12-9(15)6-3-1-2-4-11-6/h1-4,7H,5H2,(H,12,15)(H,13,14,16) |
| InChIKey | URQQAPBNCXLLIK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|