C10H12N2O3S — CID 68737166
N-(2,2-dihydroxythiolan-3-yl)pyridine-2-carboxamide (PubChem CID 68737166) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is N-(2,2-dihydroxythiolan-3-yl)pyridine-2-carboxamide.
| Compound Name | N-(2,2-dihydroxythiolan-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68737166 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | N-(2,2-dihydroxythiolan-3-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCSC1(O)O)c1ccccn1 |
| InChI | InChI=1S/C10H12N2O3S/c13-9(7-3-1-2-5-11-7)12-8-4-6-16-10(8,14)15/h1-3,5,8,14-15H,4,6H2,(H,12,13) |
| InChIKey | PJWPUEXZUOCNLK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|