C11H11N3O3 — CID 110462621
1-(2,5-dioxopyrrolidin-3-yl)-3-phenylurea (PubChem CID 110462621) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-3-yl)-3-phenylurea.
| Compound Name | 1-(2,5-dioxopyrrolidin-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 110462621 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-3-yl)-3-phenylurea |
| SMILES | O=C1CC(NC(=O)Nc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H11N3O3/c15-9-6-8(10(16)14-9)13-11(17)12-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,12,13,17)(H,14,15,16) |
| InChIKey | LBIVUJUUYBYWJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|