C16H20N4O5 — CID 97253621
ethyl N-[4-[[(3R)-2,6-dioxopiperidin-3-yl]carbamoylamino]phenyl]-N-methylcarbamate (PubChem CID 97253621) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is ethyl N-[4-[[(3R)-2,6-dioxopiperidin-3-yl]carbamoylamino]phenyl]-N-methylcarbamate.
| Compound Name | ethyl N-[4-[[(3R)-2,6-dioxopiperidin-3-yl]carbamoylamino]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 97253621 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | ethyl N-[4-[[(3R)-2,6-dioxopiperidin-3-yl]carbamoylamino]phenyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)c1ccc(NC(=O)N[C@@H]2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H20N4O5/c1-3-25-16(24)20(2)11-6-4-10(5-7-11)17-15(23)18-12-8-9-13(21)19-14(12)22/h4-7,12H,3,8-9H2,1-2H3,(H2,17,18,23)(H,19,21,22)/t12-/m1/s1 |
| InChIKey | UAMKJYXYKBHTHY-GFCCVEGCSA-N |
| XLogP | 1.21 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|