C18H20FN3O3 — CID 47070316
ethyl N-[4-[(2-fluorophenyl)methylcarbamoylamino]phenyl]-N-methylcarbamate (PubChem CID 47070316) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is ethyl N-[4-[(2-fluorophenyl)methylcarbamoylamino]phenyl]-N-methylcarbamate.
| Compound Name | ethyl N-[4-[(2-fluorophenyl)methylcarbamoylamino]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 47070316 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | ethyl N-[4-[(2-fluorophenyl)methylcarbamoylamino]phenyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)c1ccc(NC(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c1-3-25-18(24)22(2)15-10-8-14(9-11-15)21-17(23)20-12-13-6-4-5-7-16(13)19/h4-11H,3,12H2,1-2H3,(H2,20,21,23) |
| InChIKey | LGWJWCOVJOGSDS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |