C12H12F3NO3 — CID 112743058
ethyl 2,2-difluoro-3-[(2-fluorophenyl)methylamino]-3-oxopropanoate (PubChem CID 112743058) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-[(2-fluorophenyl)methylamino]-3-oxopropanoate.
| Compound Name | ethyl 2,2-difluoro-3-[(2-fluorophenyl)methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 112743058 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | ethyl 2,2-difluoro-3-[(2-fluorophenyl)methylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C12H12F3NO3/c1-2-19-11(18)12(14,15)10(17)16-7-8-5-3-4-6-9(8)13/h3-6H,2,7H2,1H3,(H,16,17) |
| InChIKey | VYVALDINFBOUHE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|