C15H21FO3 — CID 114834438
ethyl 4-(2-fluorophenyl)-3-hydroxy-2,2,3-trimethylbutanoate (PubChem CID 114834438) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is ethyl 4-(2-fluorophenyl)-3-hydroxy-2,2,3-trimethylbutanoate.
| Compound Name | ethyl 4-(2-fluorophenyl)-3-hydroxy-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 114834438 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethyl 4-(2-fluorophenyl)-3-hydroxy-2,2,3-trimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)(O)Cc1ccccc1F |
| InChI | InChI=1S/C15H21FO3/c1-5-19-13(17)14(2,3)15(4,18)10-11-8-6-7-9-12(11)16/h6-9,18H,5,10H2,1-4H3 |
| InChIKey | PEKDQPYNFRIGHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |