C12H11FO4 — CID 67469685
ethyl 4-(2-fluorophenyl)-2,3-dioxobutanoate (PubChem CID 67469685) has the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. Its IUPAC name is ethyl 4-(2-fluorophenyl)-2,3-dioxobutanoate.
| Compound Name | ethyl 4-(2-fluorophenyl)-2,3-dioxobutanoate |
|---|---|
| PubChem CID | 67469685 |
| Molecular Formula | C12H11FO4 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | ethyl 4-(2-fluorophenyl)-2,3-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C12H11FO4/c1-2-17-12(16)11(15)10(14)7-8-5-3-4-6-9(8)13/h3-6H,2,7H2,1H3 |
| InChIKey | IEWRQSFVRVWPIB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|