C12H15FN2O3 — CID 17174428
ethyl 2-[(2-fluorophenyl)methylcarbamoylamino]acetate (PubChem CID 17174428) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is ethyl 2-[(2-fluorophenyl)methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[(2-fluorophenyl)methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 17174428 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 2-[(2-fluorophenyl)methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccccc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-2-18-11(16)8-15-12(17)14-7-9-5-3-4-6-10(9)13/h3-6H,2,7-8H2,1H3,(H2,14,15,17) |
| InChIKey | IHFDFVUQQHLENJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |