C14H22FNO — CID 114835046
3-(aminomethyl)-1-(2-fluorophenyl)-2,3-dimethylpentan-2-ol (PubChem CID 114835046) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(2-fluorophenyl)-2,3-dimethylpentan-2-ol.
| Compound Name | 3-(aminomethyl)-1-(2-fluorophenyl)-2,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 114835046 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-(aminomethyl)-1-(2-fluorophenyl)-2,3-dimethylpentan-2-ol |
| SMILES | CCC(C)(CN)C(C)(O)Cc1ccccc1F |
| InChI | InChI=1S/C14H22FNO/c1-4-13(2,10-16)14(3,17)9-11-7-5-6-8-12(11)15/h5-8,17H,4,9-10,16H2,1-3H3 |
| InChIKey | UCWSUSPCINRYDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |