C16H20F4N2O4 — CID 42583501
ethyl (2S)-2-ethoxy-3,3,3-trifluoro-2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoate (PubChem CID 42583501) has the molecular formula C16H20F4N2O4 and a molecular weight of 380.34 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3,3,3-trifluoro-2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3,3,3-trifluoro-2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 42583501 |
| Molecular Formula | C16H20F4N2O4 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3,3,3-trifluoro-2-[2-(2-fluorophenyl)ethylcarbamoylamino]propanoate |
| SMILES | CCOC(=O)[C@](NC(=O)NCCc1ccccc1F)(OCC)C(F)(F)F |
| InChI | InChI=1S/C16H20F4N2O4/c1-3-25-13(23)15(26-4-2,16(18,19)20)22-14(24)21-10-9-11-7-5-6-8-12(11)17/h5-8H,3-4,9-10H2,1-2H3,(H2,21,22,24)/t15-/m0/s1 |
| InChIKey | TVIMAYMEQGLOKE-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|