C22H33NO3 — CID 58413561
4-decoxy-N-[(1R)-2-oxocyclopentyl]benzamide (PubChem CID 58413561) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-decoxy-N-[(1R)-2-oxocyclopentyl]benzamide.
| Compound Name | 4-decoxy-N-[(1R)-2-oxocyclopentyl]benzamide |
|---|---|
| PubChem CID | 58413561 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 4-decoxy-N-[(1R)-2-oxocyclopentyl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)N[C@@H]2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-2-3-4-5-6-7-8-9-17-26-19-15-13-18(14-16-19)22(25)23-20-11-10-12-21(20)24/h13-16,20H,2-12,17H2,1H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | WRUNOJNZZZECBD-HXUWFJFHSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|