C24H38N2O2 — CID 171980771
4-decoxy-N-[(E)-(3-methylcyclohexylidene)amino]benzamide (PubChem CID 171980771) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-decoxy-N-[(E)-(3-methylcyclohexylidene)amino]benzamide.
| Compound Name | 4-decoxy-N-[(E)-(3-methylcyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 171980771 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 4-decoxy-N-[(E)-(3-methylcyclohexylidene)amino]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)N/N=C2\CCCC(C)C2)cc1 |
| InChI | InChI=1S/C24H38N2O2/c1-3-4-5-6-7-8-9-10-18-28-23-16-14-21(15-17-23)24(27)26-25-22-13-11-12-20(2)19-22/h14-17,20H,3-13,18-19H2,1-2H3,(H,26,27)/b25-22+ |
| InChIKey | XNWGZWFANPMOHG-YYDJUVGSSA-N |
| XLogP | 6.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|