C16H20N2 — CID 22758233
3-(3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 22758233) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-(3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)pyridine.
| Compound Name | 3-(3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 22758233 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-(3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | C1=C(c2cccnc2)CCC=C1N1CCCCC1 |
| InChI | InChI=1S/C16H20N2/c1-2-10-18(11-3-1)16-8-4-6-14(12-16)15-7-5-9-17-13-15/h5,7-9,12-13H,1-4,6,10-11H2 |
| InChIKey | PZVNASVJACMGGP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |