C11H14N2 — CID 10942960
3-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)pyridine (PubChem CID 10942960) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)pyridine.
| Compound Name | 3-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)pyridine |
|---|---|
| PubChem CID | 10942960 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-(1-methyl-3,4-dihydro-2H-pyridin-5-yl)pyridine |
| SMILES | CN1C=C(c2cccnc2)CCC1 |
| InChI | InChI=1S/C11H14N2/c1-13-7-3-5-11(9-13)10-4-2-6-12-8-10/h2,4,6,8-9H,3,5,7H2,1H3 |
| InChIKey | ZUEXYHSUTFFIBD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |