C10H12Br2N2 — CID 629258
3,5-dibromo-4-piperidin-1-ylpyridine (PubChem CID 629258) has the molecular formula C10H12Br2N2 and a molecular weight of 320.03 g/mol. Its IUPAC name is 3,5-dibromo-4-piperidin-1-ylpyridine.
| Compound Name | 3,5-dibromo-4-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 629258 |
| Molecular Formula | C10H12Br2N2 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 3,5-dibromo-4-piperidin-1-ylpyridine |
| SMILES | Brc1cncc(Br)c1N1CCCCC1 |
| InChI | InChI=1S/C10H12Br2N2/c11-8-6-13-7-9(12)10(8)14-4-2-1-3-5-14/h6-7H,1-5H2 |
| InChIKey | RDIICJNJPKTMGN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |