About 4-(azetidin-1-yl)-3,5-dibromopyridine
4-(azetidin-1-yl)-3,5-dibromopyridine (PubChem CID 130639085) has the molecular formula C8H8Br2N2
and a molecular weight of 291.97 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-3,5-dibromopyridine.
Molecular Properties
| Compound Name | 4-(azetidin-1-yl)-3,5-dibromopyridine |
| PubChem CID | 130639085 |
| Molecular Formula | C8H8Br2N2 |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.91 |
| IUPAC Name | 4-(azetidin-1-yl)-3,5-dibromopyridine |
| SMILES | Brc1cncc(Br)c1N1CCC1 |
| InChI | InChI=1S/C8H8Br2N2/c9-6-4-11-5-7(10)8(6)12-2-1-3-12/h4-5H,1-3H2 |
| InChIKey | HUYHJRYQICZBBE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(azetidin-1-yl)-3,5-dibromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-1-yl)-3,5-dibromopyridine?
The IUPAC name of 4-(azetidin-1-yl)-3,5-dibromopyridine (CID 130639085) is 4-(azetidin-1-yl)-3,5-dibromopyridine.
What is the SMILES notation for 4-(azetidin-1-yl)-3,5-dibromopyridine?
The canonical SMILES for 4-(azetidin-1-yl)-3,5-dibromopyridine is Brc1cncc(Br)c1N1CCC1.
What is the InChIKey of 4-(azetidin-1-yl)-3,5-dibromopyridine?
The InChIKey is HUYHJRYQICZBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2N2/c9-6-4-11-5-7(10)8(6)12-2-1-3-12/h4-5H,1-3H2.
What are the key properties of 4-(azetidin-1-yl)-3,5-dibromopyridine?
4-(azetidin-1-yl)-3,5-dibromopyridine has a molecular weight of 291.97 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-1-yl)-3,5-dibromopyridine is sourced from PubChem (CID 130639085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).