About 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene
4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene (PubChem CID 102159372) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene.
Analyze 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene?
The IUPAC name of 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene (CID 102159372) is 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene.
What is the SMILES notation for 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene?
The canonical SMILES for 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene is c1ncc2c3c1CCN3CC2.
What is the InChIKey of 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene?
The InChIKey is LYHJXKJHZCIOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-3-11-4-2-8-6-10-5-7(1)9(8)11/h5-6H,1-4H2.
What are the key properties of 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene?
4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene has a molecular weight of 146.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-diazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene is sourced from PubChem (CID 102159372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).