About 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene
3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene (PubChem CID 11829877) has the molecular formula C11H10N2
and a molecular weight of 170.22 g/mol. Its IUPAC name is 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene.
Analyze 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene?
The IUPAC name of 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene (CID 11829877) is 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene.
What is the SMILES notation for 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene?
The canonical SMILES for 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene is c1ncc2cncc3c2c1CCC3.
What is the InChIKey of 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene?
The InChIKey is GVTKQUZZAZTPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-8-4-12-6-10-7-13-5-9(3-1)11(8)10/h4-7H,1-3H2.
What are the key properties of 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene?
3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene has a molecular weight of 170.22 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9(13)-pentaene is sourced from PubChem (CID 11829877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).