About 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene
8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene (PubChem CID 177102462) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene.
Analyze 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The IUPAC name of 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene (CID 177102462) is 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene.
What is the SMILES notation for 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The canonical SMILES for 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene is Cc1ccc2c3c1CCN3CC2.
What is the InChIKey of 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The InChIKey is DRHVRHFIWPZMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-2-3-9-4-6-12-7-5-10(8)11(9)12/h2-3H,4-7H2,1H3.
What are the key properties of 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene has a molecular weight of 159.23 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene is sourced from PubChem (CID 177102462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).