C13H17N — CID 23382333
1,6,6-trimethyl-3,7-dihydro-2H-cyclobuta[g]indole (PubChem CID 23382333) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1,6,6-trimethyl-3,7-dihydro-2H-cyclobuta[g]indole.
| Compound Name | 1,6,6-trimethyl-3,7-dihydro-2H-cyclobuta[g]indole |
|---|---|
| PubChem CID | 23382333 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1,6,6-trimethyl-3,7-dihydro-2H-cyclobuta[g]indole |
| SMILES | CN1CCc2ccc3c(c21)CC3(C)C |
| InChI | InChI=1S/C13H17N/c1-13(2)8-10-11(13)5-4-9-6-7-14(3)12(9)10/h4-5H,6-8H2,1-3H3 |
| InChIKey | LAILBNXMKDHODC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |