C10H14N2 — CID 22943239
N,1-dimethyl-2,3-dihydroindol-7-amine (PubChem CID 22943239) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N,1-dimethyl-2,3-dihydroindol-7-amine.
| Compound Name | N,1-dimethyl-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 22943239 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N,1-dimethyl-2,3-dihydroindol-7-amine |
| SMILES | CNc1cccc2c1N(C)CC2 |
| InChI | InChI=1S/C10H14N2/c1-11-9-5-3-4-8-6-7-12(2)10(8)9/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | NAYJEWALQKYNPR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |