C13H18N2O — CID 84683935
1-methyl-7-pyrrolidin-3-yloxy-2,3-dihydroindole (PubChem CID 84683935) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-methyl-7-pyrrolidin-3-yloxy-2,3-dihydroindole.
| Compound Name | 1-methyl-7-pyrrolidin-3-yloxy-2,3-dihydroindole |
|---|---|
| PubChem CID | 84683935 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-methyl-7-pyrrolidin-3-yloxy-2,3-dihydroindole |
| SMILES | CN1CCc2cccc(OC3CCNC3)c21 |
| InChI | InChI=1S/C13H18N2O/c1-15-8-6-10-3-2-4-12(13(10)15)16-11-5-7-14-9-11/h2-4,11,14H,5-9H2,1H3 |
| InChIKey | WUZCMNDYOAIQSD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |