C10H15N3 — CID 10035152
2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine (PubChem CID 10035152) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine.
| Compound Name | 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine |
|---|---|
| PubChem CID | 10035152 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| SMILES | CN1CCc2ccc(N)c(N)c2C1 |
| InChI | InChI=1S/C10H15N3/c1-13-5-4-7-2-3-9(11)10(12)8(7)6-13/h2-3H,4-6,11-12H2,1H3 |
| InChIKey | VVEJOJNSVZAKJZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|