About 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine
2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine (PubChem CID 10035152) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| PubChem CID | 10035152 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| SMILES | CN1CCc2ccc(N)c(N)c2C1 |
| InChI | InChI=1S/C10H15N3/c1-13-5-4-7-2-3-9(11)10(12)8(7)6-13/h2-3H,4-6,11-12H2,1H3 |
| InChIKey | VVEJOJNSVZAKJZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The IUPAC name of 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine (CID 10035152) is 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine.
What is the SMILES notation for 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The canonical SMILES for 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine is CN1CCc2ccc(N)c(N)c2C1.
What is the InChIKey of 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine?
The InChIKey is VVEJOJNSVZAKJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-13-5-4-7-2-3-9(11)10(12)8(7)6-13/h2-3H,4-6,11-12H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine?
2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine has a molecular weight of 177.25 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-1H-isoquinoline-7,8-diamine is sourced from PubChem (CID 10035152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).