C8H12N2 — CID 521077
3,4-dimethylbenzene-1,2-diamine (PubChem CID 521077) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 3,4-dimethylbenzene-1,2-diamine.
| Compound Name | 3,4-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 521077 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3,4-dimethylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(N)c1C |
| InChI | InChI=1S/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
| InChIKey | MHQULXYNBKWNDF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|