C13H21BrN4 — CID 103517907
5-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]pyridin-3-amine (PubChem CID 103517907) has the molecular formula C13H21BrN4 and a molecular weight of 313.24 g/mol. Its IUPAC name is 5-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]pyridin-3-amine.
| Compound Name | 5-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 103517907 |
| Molecular Formula | C13H21BrN4 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]pyridin-3-amine |
| SMILES | CN(C)CC1CCN(c2c(N)cncc2Br)CC1 |
| InChI | InChI=1S/C13H21BrN4/c1-17(2)9-10-3-5-18(6-4-10)13-11(14)7-16-8-12(13)15/h7-8,10H,3-6,9,15H2,1-2H3 |
| InChIKey | TZYUQTIJALPEAO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |