C14H22N2 — CID 173070940
1-cyclobutyl-4-cyclohexa-1,5-dien-1-ylpiperazine (PubChem CID 173070940) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-cyclobutyl-4-cyclohexa-1,5-dien-1-ylpiperazine.
| Compound Name | 1-cyclobutyl-4-cyclohexa-1,5-dien-1-ylpiperazine |
|---|---|
| PubChem CID | 173070940 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-cyclobutyl-4-cyclohexa-1,5-dien-1-ylpiperazine |
| SMILES | C1=CC(N2CCN(C3CCC3)CC2)=CCC1 |
| InChI | InChI=1S/C14H22N2/c1-2-5-13(6-3-1)15-9-11-16(12-10-15)14-7-4-8-14/h2,5-6,14H,1,3-4,7-12H2 |
| InChIKey | NHGNXYPTIYIUNH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |