C12H21N — CID 102449509
(5Z,8S)-1-azabicyclo[6.5.0]tridec-5-ene (PubChem CID 102449509) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (5Z,8S)-1-azabicyclo[6.5.0]tridec-5-ene.
| Compound Name | (5Z,8S)-1-azabicyclo[6.5.0]tridec-5-ene |
|---|---|
| PubChem CID | 102449509 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (5Z,8S)-1-azabicyclo[6.5.0]tridec-5-ene |
| SMILES | C1=C\C[C@@H]2CCCCCN2CCC/1 |
| InChI | InChI=1S/C12H21N/c1-2-6-10-13-11-7-3-5-9-12(13)8-4-1/h1,4,12H,2-3,5-11H2/b4-1-/t12-/m1/s1 |
| InChIKey | IHLUGXPCIRIPEM-VCUZLRKMSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|