C20H36N2 — CID 173264965
(7Z)-1-cycloundec-5-en-1-yl-1,3-diazacycloundec-7-ene (PubChem CID 173264965) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is (7Z)-1-cycloundec-5-en-1-yl-1,3-diazacycloundec-7-ene.
| Compound Name | (7Z)-1-cycloundec-5-en-1-yl-1,3-diazacycloundec-7-ene |
|---|---|
| PubChem CID | 173264965 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | (7Z)-1-cycloundec-5-en-1-yl-1,3-diazacycloundec-7-ene |
| SMILES | C1=CCCCC(N2CCC/C=C\CCCNC2)CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-8-12-16-20(15-11-7-3-1)22-18-14-10-6-5-9-13-17-21-19-22/h1,3,5-6,20-21H,2,4,7-19H2/b3-1?,6-5- |
| InChIKey | VAHXJQLNRSQLKP-MMTMFTEJSA-N |
| XLogP | 5.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|