C16H28N2 — CID 70524739
2-cyclonon-5-en-1-yl-1,3,4,5,8,9-hexahydrodiazonine (PubChem CID 70524739) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-cyclonon-5-en-1-yl-1,3,4,5,8,9-hexahydrodiazonine.
| Compound Name | 2-cyclonon-5-en-1-yl-1,3,4,5,8,9-hexahydrodiazonine |
|---|---|
| PubChem CID | 70524739 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-cyclonon-5-en-1-yl-1,3,4,5,8,9-hexahydrodiazonine |
| SMILES | C1=CCCCC(N2CCCC=CCCN2)CCC1 |
| InChI | InChI=1S/C16H28N2/c1-2-5-9-13-16(12-8-4-1)18-15-11-7-3-6-10-14-17-18/h1-3,6,16-17H,4-5,7-15H2 |
| InChIKey | XYBNNQNXQYTMGG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|