C10H21N3 — CID 135257321
1-cyclooctyl-1,2,4-triazolidine (PubChem CID 135257321) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-cyclooctyl-1,2,4-triazolidine.
| Compound Name | 1-cyclooctyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 135257321 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-cyclooctyl-1,2,4-triazolidine |
| SMILES | C1CCCC(N2CNCN2)CCC1 |
| InChI | InChI=1S/C10H21N3/c1-2-4-6-10(7-5-3-1)13-9-11-8-12-13/h10-12H,1-9H2 |
| InChIKey | JSRYMFMZZCPYSJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |