C9H15N — CID 557967
2,3,4,6,9,9a-hexahydro-1H-quinolizine (PubChem CID 557967) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 2,3,4,6,9,9a-hexahydro-1H-quinolizine.
| Compound Name | 2,3,4,6,9,9a-hexahydro-1H-quinolizine |
|---|---|
| PubChem CID | 557967 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2,3,4,6,9,9a-hexahydro-1H-quinolizine |
| SMILES | C1=CCN2CCCCC2C1 |
| InChI | InChI=1S/C9H15N/c1-3-7-10-8-4-2-6-9(10)5-1/h1,3,9H,2,4-8H2 |
| InChIKey | UVGIYZMSZBBREW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|