About 1-cyclohex-3-en-1-ylazetidine;ethane;propane
1-cyclohex-3-en-1-ylazetidine;ethane;propane (PubChem CID 145406615) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-ylazetidine;ethane;propane.
Molecular Properties
| Compound Name | 1-cyclohex-3-en-1-ylazetidine;ethane;propane |
| PubChem CID | 145406615 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1-cyclohex-3-en-1-ylazetidine;ethane;propane |
| SMILES | C1=CCC(N2CCC2)CC1.CC.CCC |
| InChI | InChI=1S/C9H15N.C3H8.C2H6/c1-2-5-9(6-3-1)10-7-4-8-10;1-3-2;1-2/h1-2,9H,3-8H2;3H2,1-2H3;1-2H3 |
| InChIKey | QFULTFWNPMYWRR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohex-3-en-1-ylazetidine;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohex-3-en-1-ylazetidine;ethane;propane?
The IUPAC name of 1-cyclohex-3-en-1-ylazetidine;ethane;propane (CID 145406615) is 1-cyclohex-3-en-1-ylazetidine;ethane;propane.
What is the SMILES notation for 1-cyclohex-3-en-1-ylazetidine;ethane;propane?
The canonical SMILES for 1-cyclohex-3-en-1-ylazetidine;ethane;propane is C1=CCC(N2CCC2)CC1.CC.CCC.
What is the InChIKey of 1-cyclohex-3-en-1-ylazetidine;ethane;propane?
The InChIKey is QFULTFWNPMYWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.C3H8.C2H6/c1-2-5-9(6-3-1)10-7-4-8-10;1-3-2;1-2/h1-2,9H,3-8H2;3H2,1-2H3;1-2H3.
What are the key properties of 1-cyclohex-3-en-1-ylazetidine;ethane;propane?
1-cyclohex-3-en-1-ylazetidine;ethane;propane has a molecular weight of 211.39 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohex-3-en-1-ylazetidine;ethane;propane is sourced from PubChem (CID 145406615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).