C12H24N2 — CID 144528280
ethane;1-methyl-3,4,6,7,10,10a-hexahydro-2H-pyrimido[1,2-a]azepine (PubChem CID 144528280) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;1-methyl-3,4,6,7,10,10a-hexahydro-2H-pyrimido[1,2-a]azepine.
| Compound Name | ethane;1-methyl-3,4,6,7,10,10a-hexahydro-2H-pyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 144528280 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;1-methyl-3,4,6,7,10,10a-hexahydro-2H-pyrimido[1,2-a]azepine |
| SMILES | CC.CN1CCCN2CCC=CCC12 |
| InChI | InChI=1S/C10H18N2.C2H6/c1-11-7-5-9-12-8-4-2-3-6-10(11)12;1-2/h2-3,10H,4-9H2,1H3;1-2H3 |
| InChIKey | QUCUVOYIFOVFLX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|