C11H23N3 — CID 167009896
1-methyl-3-(1-methylpiperidin-4-yl)-1,3-diazinane (PubChem CID 167009896) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-methyl-3-(1-methylpiperidin-4-yl)-1,3-diazinane.
| Compound Name | 1-methyl-3-(1-methylpiperidin-4-yl)-1,3-diazinane |
|---|---|
| PubChem CID | 167009896 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-methyl-3-(1-methylpiperidin-4-yl)-1,3-diazinane |
| SMILES | CN1CCC(N2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C11H23N3/c1-12-8-4-11(5-9-12)14-7-3-6-13(2)10-14/h11H,3-10H2,1-2H3 |
| InChIKey | OXPGIEPXLVRPAO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |