C6H15N3 — CID 123639492
1,3-dimethyl-1,3-diazinan-2-amine (PubChem CID 123639492) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diazinan-2-amine.
| Compound Name | 1,3-dimethyl-1,3-diazinan-2-amine |
|---|---|
| PubChem CID | 123639492 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1,3-dimethyl-1,3-diazinan-2-amine |
| SMILES | CN1CCCN(C)C1N |
| InChI | InChI=1S/C6H15N3/c1-8-4-3-5-9(2)6(8)7/h6H,3-5,7H2,1-2H3 |
| InChIKey | CNSSBEYDUAPHPC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |