C8H20N4 — CID 130591183
(1,4-dimethyl-1,4-diazepan-2-yl)methylhydrazine (PubChem CID 130591183) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is (1,4-dimethyl-1,4-diazepan-2-yl)methylhydrazine.
| Compound Name | (1,4-dimethyl-1,4-diazepan-2-yl)methylhydrazine |
|---|---|
| PubChem CID | 130591183 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | (1,4-dimethyl-1,4-diazepan-2-yl)methylhydrazine |
| SMILES | CN1CCCN(C)C(CNN)C1 |
| InChI | InChI=1S/C8H20N4/c1-11-4-3-5-12(2)8(7-11)6-10-9/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | RBDRPPZRTLVWMV-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|