C6H16N4 — CID 174832222
1,3,5-trimethyl-1,3,5-triazinan-2-amine (PubChem CID 174832222) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,3,5-trimethyl-1,3,5-triazinan-2-amine.
| Compound Name | 1,3,5-trimethyl-1,3,5-triazinan-2-amine |
|---|---|
| PubChem CID | 174832222 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 1,3,5-trimethyl-1,3,5-triazinan-2-amine |
| SMILES | CN1CN(C)C(N)N(C)C1 |
| InChI | InChI=1S/C6H16N4/c1-8-4-9(2)6(7)10(3)5-8/h6H,4-5,7H2,1-3H3 |
| InChIKey | APZLFUWCPYZDLR-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |