C6H15Cl3CrN3+ — CID 87195451
trichlorochromium(1+);1,3,5-trimethyl-1,3,5-triazinane (PubChem CID 87195451) has the molecular formula C6H15Cl3CrN3+ and a molecular weight of 287.56 g/mol. Its IUPAC name is trichlorochromium(1+);1,3,5-trimethyl-1,3,5-triazinane.
| Compound Name | trichlorochromium(1+);1,3,5-trimethyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 87195451 |
| Molecular Formula | C6H15Cl3CrN3+ |
| Molecular Weight | 287.56 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | trichlorochromium(1+);1,3,5-trimethyl-1,3,5-triazinane |
| SMILES | CN1CN(C)CN(C)C1.Cl[Cr+](Cl)Cl |
| InChI | InChI=1S/C6H15N3.3ClH.Cr/c1-7-4-8(2)6-9(3)5-7;;;;/h4-6H2,1-3H3;3*1H;/q;;;;+4/p-3 |
| InChIKey | KQWHMHQNDZTRQX-UHFFFAOYSA-K |
| XLogP | 1.73 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |